N-Lauroylsarcosine Sodium Salt ≥94%

(đánh giá) 0 đã bán

Liên hệ để báo giá

N-Lauroylsarcosine Sodium Salt ≥94%

  1. Mã code: L5125
  2. Mã cas: 137-16-6
  3. Quy cách: 50G, 100G, 500G, 1KG
  4. Tên gọi khác: N-Dodecanoyl-N-methylglycine sodium salt, Sarkosyl NL
  5. Molecular Weight CH3(CH2)10CON(CH3)CH2COONa =293.38
  6. description anionic
  7. assay ≥94%
  8. Dạng bột
  9. mol wt micellar avg mol wt 600 average mol wt 600
  10. Hãng Sigma ALdrich


Thông báo Himedia